| Product Name | 1-(4-bromophenyl)cyclopropanecarbonitrile |
| CAS No. | 124276-67-1 |
| Synonyms | 4-(4-bromophenyl)-2-methylpyrimidine; 1-(4-Bromophenyl)-cyclopropane carbonitrile; 1-(4-broMophenyl)cyclopropane-1-carbonitrile |
| InChI | InChI=1/C11H9BrN2/c1-8-13-7-6-11(14-8)9-2-4-10(12)5-3-9/h2-7H,1H3 |
| Molecular Formula | C11H9BrN2 |
| Molecular Weight | 249.1066 |
| Density | 1.434g/cm3 |
| Melting point | 84℃ |
| Boiling point | 341.4°C at 760 mmHg |
| Flash point | 160.3°C |
| Refractive index | 1.601 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
124276-67-1 1-(4-bromophenyl)cyclopropanecarbonitrile
service@apichina.com