| Product Name | 1,4-Bis(1-hydroxycyclohexyl)-1,3-butadiyne |
| CAS No. | 5768-10-5 |
| Synonyms | Cyclohexanol, 1,1'-butadiynylenedi-; 4-06-00-06483 (Beilstein Handbook Reference); BRN 1246867; Bis(1-hydroxycyclohexyl)butadiyne; NSC 407601; Cyclohexanol, 1,1'-(1,3-butadiyne-1,4-diyl)bis- (9CI); 1,1'-buta-1,3-diyne-1,4-diyldicyclohexanol; 5-{2-[4-(dimethylamino)phenyl]ethenyl}-6-methyl-1,2,4-triazine-3(2H)-thione |
| InChI | InChI=1/C14H16N4S/c1-10-13(15-14(19)17-16-10)9-6-11-4-7-12(8-5-11)18(2)3/h4-9H,1-3H3,(H,15,17,19) |
| Molecular Formula | C14H16N4S |
| Molecular Weight | 272.3686 |
| Density | 1.17g/cm3 |
| Boiling point | 420.8°C at 760 mmHg |
| Flash point | 208.3°C |
| Refractive index | 1.623 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
5768-10-5 1,4-bis(1-hydroxycyclohexyl)-1,3-butadiyne
service@apichina.com