| Product Name | 1-(4-Biphenylyl)ethanol |
| CAS No. | 3562-73-0 |
| Synonyms | 4-Biphenylyl methyl carbinol~4-(1-Hydroxyethyl)biphenyl~alpha-Methyl-4-phenylbenzyl alcohol; 4-(1-Hydroxyethyl)biphenyl; 1-(biphenyl-4-yl)ethanol |
| InChI | InChI=1/C14H14O/c1-11(15)12-7-9-14(10-8-12)13-5-3-2-4-6-13/h2-11,15H,1H3 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.2604 |
| Density | 1.067g/cm3 |
| Melting point | 95-97℃ |
| Boiling point | 340.4°C at 760 mmHg |
| Flash point | 148.6°C |
| Refractive index | 1.581 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
3562-73-0 1-(4-biphenylyl)ethanol
service@apichina.com