| Product Name | 1,4-Benzenedithiol |
| CAS No. | 624-39-5 |
| Synonyms | 1,4-Dimercaptobenzene; Dithiohydroquinone; benzene-1,4-dithiol; benzene-1,4-bis(thiolate) |
| InChI | InChI=1/C6H6S2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H/p-2 |
| Molecular Formula | C6H4S2 |
| Molecular Weight | 140.2271 |
| Boiling point | 243.3°C at 760 mmHg |
| Flash point | 111.8°C |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S22:Do not inhale dust.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
624-39-5 1,4-benzenedithiol
service@apichina.com