| Product Name | 1-{4-[4-ethoxy-3,5-bis(1-methylpropyl)phenyl]-1,3-thiazol-2-yl}-1H-pyrrole-2-carbaldehyde |
| CAS No. | 4977-39-3 |
| InChI | InChI=1/C24H30N2O2S/c1-6-16(4)20-12-18(13-21(17(5)7-2)23(20)28-8-3)22-15-29-24(25-22)26-11-9-10-19(26)14-27/h9-17H,6-8H2,1-5H3 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.5722 |
| Density | 1.13g/cm3 |
| Boiling point | 579.4°C at 760 mmHg |
| Flash point | 304.2°C |
| Refractive index | 1.585 |
4977-39-3 1-{4-[4-ethoxy-3,5-bis(1-methylpropyl)phenyl]-1,3-thiazol-2-yl}-1h-pyrrole-2-carbaldehyde
service@apichina.com