| Product Name | 1,3-Thiazolin-4-one-2-acetonitrile |
| CAS No. | 74246-64-3 |
| Synonyms | 2-(4-Oxo-4,5-dihydro-1,3-thiazol-2-yl)acetonitrile; (4-oxo-4,5-dihydro-1,3-thiazol-2-yl)acetonitrile |
| InChI | InChI=1/C5H4N2OS/c6-2-1-5-7-4(8)3-9-5/h1,3H2 |
| Molecular Formula | C5H4N2OS |
| Molecular Weight | 140.1631 |
| Density | 1.43g/cm3 |
| Melting point | 185℃ |
| Boiling point | 300.6°C at 760 mmHg |
| Flash point | 135.6°C |
| Refractive index | 1.675 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
74246-64-3 1,3-thiazolin-4-one-2-acetonitrile
service@apichina.com