| Product Name | 1,3-Phenylenediacetic acid |
| CAS No. | 19806-17-8 |
| Synonyms | m-Phenylendiacetic acid; Benzene-1,3-diacetic acid; 1,3-Bis-(carboxymethyl)-benzene; 2,2'-benzene-1,2-diyldiacetic acid; 2,2'-benzene-1,3-diyldiacetic acid; 2,2'-benzene-1,3-diyldiacetate |
| InChI | InChI=1/C10H10O4/c11-9(12)5-7-2-1-3-8(4-7)6-10(13)14/h1-4H,5-6H2,(H,11,12)(H,13,14)/p-2 |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.1692 |
| Melting point | 173-177℃ |
| Boiling point | 408.6°C at 760 mmHg |
| Flash point | 215.1°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
19806-17-8 1,3-phenylenediacetic acid
service@apichina.com