| Product Name | 1-(3-Methylphenyl)-piperazine |
| CAS No. | 41186-03-2 |
| Synonyms | N-(m-Tolyl)piperazine; 1-(3-Methylphenyl)piperazine; 1-m-tolylpiperazine |
| InChI | InChI=1/C11H16N2/c1-10-3-2-4-11(9-10)13-7-5-12-6-8-13/h2-4,9,12H,5-8H2,1H3 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.2581 |
| Density | 1.012g/cm3 |
| Boiling point | 321.4°C at 760 mmHg |
| Flash point | 154°C |
| Refractive index | 1.54 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
41186-03-2 1-(3-methylphenyl)-piperazine
service@apichina.com