| Product Name | 1-(3-Methoxyphenyl)-1H-pyrrole-2,5-dione |
| CAS No. | 3007-23-6 |
| Synonyms | 1-(3-Methoxyphenyl)-2,5-dihydro-1H-pyrrole-2,5-dione |
| InChI | InChI=1/C11H9NO3/c1-15-9-4-2-3-8(7-9)12-10(13)5-6-11(12)14/h2-7H,1H3 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.1941 |
| Density | 1.317g/cm3 |
| Melting point | 62℃ |
| Boiling point | 358.5°C at 760 mmHg |
| Flash point | 170.6°C |
| Refractive index | 1.603 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
3007-23-6 1-(3-methoxyphenyl)-1h-pyrrole-2,5-dione
service@apichina.com