| Product Name | 1,3-Diphenyl-2,3-epoxy-1-propanone |
| CAS No. | 5411-12-1 |
| Synonyms | Chalcone alpha,beta-epoxide; Benyzlideneacetophenone epoxide~2-Benzoyl-3-phenyloxirane; phenyl(3-phenyloxiran-2-yl)methanone |
| InChI | InChI=1/C15H12O2/c16-13(11-7-3-1-4-8-11)15-14(17-15)12-9-5-2-6-10-12/h1-10,14-15H |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.2546 |
| Density | 1.209g/cm3 |
| Boiling point | 374.1°C at 760 mmHg |
| Flash point | 174°C |
| Refractive index | 1.617 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5411-12-1 1,3-diphenyl-2,3-epoxy-1-propanone
service@apichina.com