| Product Name | 1,3-Dimethyl-5-morpholino-1H-pyrazol-4- amine |
| CAS No. | 568577-87-7 |
| Synonyms | 1,3-dimethyl-5-morpholin-4-yl-1H-pyrazol-4-amine |
| InChI | InChI=1/C9H16N4O/c1-7-8(10)9(12(2)11-7)13-3-5-14-6-4-13/h3-6,10H2,1-2H3 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.2495 |
| Density | 1.32g/cm3 |
| Melting point | 155℃ |
| Boiling point | 389.2°C at 760 mmHg |
| Flash point | 189.2°C |
| Refractive index | 1.63 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
568577-87-7 1,3-dimethyl-5-morpholino-1h-pyrazol-4- amine
service@apichina.com