| Product Name | 1,3-dimethyl-1H-thieno[2,3-c]pyrazole-5-carboxylic acid |
| CAS No. | 25252-46-4 |
| InChI | InChI=1/C8H8N2O2S/c1-4-5-3-6(8(11)12)13-7(5)10(2)9-4/h3H,1-2H3,(H,11,12) |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.2263 |
| Density | 1.54g/cm3 |
| Melting point | 316℃ |
| Boiling point | 401.5°C at 760 mmHg |
| Flash point | 196.6°C |
| Refractive index | 1.724 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
25252-46-4 1,3-dimethyl-1h-thieno[2,3-c]pyrazole-5-carboxylic acid
service@apichina.com