| Product Name | 1,3-dimethyl-1H-pyrazole-5-carbaldehyde |
| CAS No. | 25016-09-5 |
| Synonyms | 1,3-Dimethylpyrazole-5-carbaldehyde; 2,5-dimethylpyrazole-3-carbaldehyde |
| InChI | InChI=1/C6H8N2O/c1-5-3-6(4-9)8(2)7-5/h3-4H,1-2H3 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.1405 |
| Density | 1.114g/cm3 |
| Melting point | 40℃ |
| Boiling point | 227.739°C at 760 mmHg |
| Flash point | 91.534°C |
| Refractive index | 1.543 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
25016-09-5 1,3-dimethyl-1h-pyrazole-5-carbaldehyde
service@apichina.com