| Product Name | (1,3-Dimethyl-1H-pyrazol-5-yl)methylamine |
| CAS No. | 499770-63-7 |
| Synonyms | 1-(1,3-dimethyl-1H-pyrazol-5-yl)methanamine; (1,3-dimethyl-1H-pyrazol-5-yl)methanamine |
| InChI | InChI=1/C6H11N3/c1-5-3-6(4-7)9(2)8-5/h3H,4,7H2,1-2H3 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.1716 |
| Density | 1.12g/cm3 |
| Boiling point | 229.3°C at 760 mmHg |
| Flash point | 92.5°C |
| Refractive index | 1.566 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
499770-63-7 (1,3-dimethyl-1h-pyrazol-5-yl)methylamine
service@apichina.com