| Product Name | 1,3-dimethoxy-5-(2-nitroprop-1-enyl)benzene |
| CAS No. | 18917-76-5 |
| Synonyms | 1-(3,5-Dimethoxyphenyl)-2-nitroprop-1-ene; 1,3-dimethoxy-5-(2-nitroprop-1-en-1-yl)benzene |
| InChI | InChI=1/C11H13NO4/c1-8(12(13)14)4-9-5-10(15-2)7-11(6-9)16-3/h4-7H,1-3H3 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.2252 |
| Density | 1.168g/cm3 |
| Melting point | 87℃ |
| Boiling point | 358°C at 760 mmHg |
| Flash point | 159.4°C |
| Refractive index | 1.555 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
18917-76-5 1,3-dimethoxy-5-(2-nitroprop-1-enyl)benzene
service@apichina.com