| Product Name | 1,3-Dihydroxynaphthalene |
| CAS No. | 132-86-5 |
| Synonyms | 1,3-Naphthalenediol; Naphthoresorcinol; naphtharesorcinol; NAPHTORESORCINE; naphthalene-1,3-diol |
| InChI | InChI=1/C10H8O2/c11-8-5-7-3-1-2-4-9(7)10(12)6-8/h1-6,11-12H |
| Molecular Formula | C10H8O2 |
| Molecular Weight | 160.1693 |
| Density | 1.33g/cm3 |
| Melting point | 123-126℃ |
| Boiling point | 361.5°C at 760 mmHg |
| Flash point | 185.5°C |
| Refractive index | 1.725 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
132-86-5 1,3-dihydroxynaphthalene
service@apichina.com