| Product Name | 1,3-Difluoro-5-iodobenzene |
| CAS No. | 2265-91-0 |
| Synonyms | 3,5-DIFLUOROIODOBENZENE; 3,5-Difluoro iodobenzene |
| InChI | InChI=1/C6H3F2I/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| Molecular Formula | C6H3F2I |
| Molecular Weight | 239.9893 |
| Density | 2.001g/cm3 |
| Boiling point | 173.9°C at 760 mmHg |
| Flash point | 63.8°C |
| Refractive index | 1.566 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2265-91-0 1,3-difluoro-5-iodobenzene
service@apichina.com