| Product Name | 1,3-difluoro-2-propanol |
| CAS No. | 453-13-4 |
| Synonyms | Geiftor; 1,3-difluoropropan-2-one |
| InChI | InChI=1/C3H4F2O/c4-1-3(6)2-5/h1-2H2 |
| Molecular Formula | C3H4F2O |
| Molecular Weight | 94.0601 |
| Density | 1.092g/cm3 |
| Boiling point | 85.7°C at 760 mmHg |
| Flash point | 22°C |
| Refractive index | 1.304 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
453-13-4 1,3-difluoro-2-propanol
service@apichina.com