| Product Name | 1,3-diethylurea |
| CAS No. | 623-76-7 |
| Synonyms | N,N-Diethylurea; Diethylurea symmetrical; N,N'-Diethylurea |
| InChI | InChI=1/C5H12N2O/c1-3-6-5(8)7-4-2/h3-4H2,1-2H3,(H2,6,7,8) |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.1616 |
| Density | 0.923g/cm3 |
| Melting point | 112-113℃ |
| Boiling point | 263°C at 760 mmHg |
| Flash point | 121.1°C |
| Refractive index | 1.428 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
623-76-7 1,3-diethylurea
service@apichina.com
- Next:623-78-9 ethyl ethylcarbamate
- Previous:623-73-4 ethyl diazoacetate