| Product Name | 1,3-Diethoxybenzene |
| CAS No. | 2049-73-2 |
| Synonyms | 1,3-Diethoxybenzene, (Resorcinol diethyl ether); Resorsinol diethyl ether; Resorcinol diethyl ether |
| InChI | InChI=1/C10H14O2/c1-3-11-9-6-5-7-10(8-9)12-4-2/h5-8H,3-4H2,1-2H3 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.217 |
| Density | 0.975g/cm3 |
| Melting point | 10-236℃ |
| Boiling point | 238.5°C at 760 mmHg |
| Flash point | 87.1°C |
| Refractive index | 1.485 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
2049-73-2 1,3-diethoxybenzene
service@apichina.com