| Product Name | 1,3-dichloro-2-methyl-5-nitrobenzene |
| CAS No. | 7149-69-1 |
| Synonyms | 2,6-Dichloro-4-nitrotoluene |
| InChI | InChI=1/C7H5Cl2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
| Molecular Formula | C7H5Cl2NO2 |
| Molecular Weight | 206.0261 |
| Density | 1.456g/cm3 |
| Melting point | 62℃ |
| Boiling point | 279.6°C at 760 mmHg |
| Flash point | 122.9°C |
| Refractive index | 1.585 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
7149-69-1 1,3-dichloro-2-methyl-5-nitrobenzene
service@apichina.com