| Product Name | 1,3-dichloro-2-(2-nitrovinyl)benzene |
| CAS No. | 22482-43-5 |
| Synonyms | 2,6-Dichloro-ω-nitrostyrene; 2,6-Dichloro-omega-nitrostyrene; 1,3-dichloro-2-(2-nitroethenyl)benzene |
| InChI | InChI=1/C8H5Cl2NO2/c9-7-2-1-3-8(10)6(7)4-5-11(12)13/h1-5H |
| Molecular Formula | C8H5Cl2NO2 |
| Molecular Weight | 218.0368 |
| Density | 1.447g/cm3 |
| Melting point | 62℃ |
| Boiling point | 330.6°C at 760 mmHg |
| Flash point | 153.7°C |
| Refractive index | 1.626 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
22482-43-5 1,3-dichloro-2-(2-nitrovinyl)benzene
service@apichina.com