| Product Name | 1,3-Diallylurea |
| CAS No. | 1801-72-5 |
| Synonyms | NSC 102722; DAU; N,N'-Diallylurea; Urea, 1,3-diallyl- (8CI); Urea, N,N'-di-2-propenyl- (9CI); 1,3-diprop-2-en-1-ylurea |
| InChI | InChI=1/C7H12N2O/c1-3-5-8-7(10)9-6-4-2/h3-4H,1-2,5-6H2,(H2,8,9,10) |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.183 |
| Density | 0.94g/cm3 |
| Melting point | 90-93℃ |
| Boiling point | 285.3°C at 760 mmHg |
| Flash point | 129.6°C |
| Refractive index | 1.464 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
1801-72-5 1,3-diallylurea
service@apichina.com