| Product Name | 1,3-Diallyl-2-thiourea |
| CAS No. | 6601-20-3 |
| Synonyms | NN-Diallylthiourea; N,N-Diallylthiourea; N,N?Diallylthiourea; 1,3-diprop-2-en-1-ylthiourea |
| InChI | InChI=1/C7H12N2S/c1-3-5-8-7(10)9-6-4-2/h3-4H,1-2,5-6H2,(H2,8,9,10) |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.2486 |
| Density | 0.995g/cm3 |
| Melting point | 48-49℃ |
| Boiling point | 209.8°C at 760 mmHg |
| Flash point | 80.7°C |
| Refractive index | 1.529 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
6601-20-3 1,3-diallyl-2-thiourea
service@apichina.com