| Product Name | 1-(3-Chlorophenyl)piperazine |
| CAS No. | 6640-24-0 |
| Synonyms | 3-Chlorphenylpiperazine; 1-(3-Chlorphenyl)-piperazine; 3-Chlorophenyl piperazine; 1-(3-Chlorophenyl)-piperazine |
| InChI | InChI=1/C10H13ClN2/c11-9-2-1-3-10(8-9)13-6-4-12-5-7-13/h1-3,8,12H,4-7H2 |
| Molecular Formula | C10H13ClN2 |
| Molecular Weight | 196.6766 |
| Density | 1.159g/cm3 |
| Melting point | 210-214℃ |
| Boiling point | 336.4°C at 760 mmHg |
| Flash point | 157.2°C |
| Refractive index | 1.557 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
6640-24-0 1-(3-chlorophenyl)piperazine
service@apichina.com