| Product Name | 1,3-butanediol diacetate |
| CAS No. | 1117-31-3 |
| Synonyms | 1,3-butylene diacetate; 1,3-Butylene glycol diacetate; butane-1,3-diyl diacetate; 1,3-BGDA; 1,3-Diacetoxybutane |
| InChI | InChI=1/C8H14O4/c1-6(12-8(3)10)4-5-11-7(2)9/h6H,4-5H2,1-3H3 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.1944 |
| Density | 1.037g/cm3 |
| Boiling point | 228.8°C at 760 mmHg |
| Flash point | 102.6°C |
| Refractive index | 1.421 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
1117-31-3 1,3-butanediol diacetate
service@apichina.com
- Next:1117-32-4 4-iodooctane
- Previous:1117-18-6 di-n-heptyl malonate