| Product Name | 1-[3-(bromomethyl)phenyl]-1H-pyrrole |
| CAS No. | 112596-36-8 |
| InChI | InChI=1/C11H10BrN/c12-9-10-4-3-5-11(8-10)13-6-1-2-7-13/h1-8H,9H2 |
| Molecular Formula | C11H10BrN |
| Molecular Weight | 236.1078 |
| Density | 1.34g/cm3 |
| Melting point | 47℃ |
| Boiling point | 325.6°C at 760 mmHg |
| Flash point | 150.7°C |
| Refractive index | 1.593 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
112596-36-8 1-[3-(bromomethyl)phenyl]-1h-pyrrole
service@apichina.com