| Product Name | 1,3-Benzothiazole-2-carboxylic acid |
| CAS No. | 3622-04-6 |
| Synonyms | benzo[d]thiazole-2-carboxylic acid |
| InChI | InChI=1/C8H5NO2S/c10-8(11)7-9-5-3-1-2-4-6(5)12-7/h1-4H,(H,10,11) |
| Molecular Formula | C8H5NO2S |
| Molecular Weight | 179.1958 |
| Density | 1.508g/cm3 |
| Melting point | 148℃ |
| Boiling point | 378.5°C at 760 mmHg |
| Flash point | 182.7°C |
| Refractive index | 1.731 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
3622-04-6 1,3-benzothiazole-2-carboxylic acid
service@apichina.com