| Product Name | 1,3-benzothiazol-2-ylmethylamine hydrochloride |
| CAS No. | 29198-41-2 |
| Synonyms | 1-(1,3-benzothiazol-2-yl)methanamine; 1-(1,3-benzothiazol-2-yl)methanamine hydrochloride |
| InChI | InChI=1/C8H8N2S.ClH/c9-5-8-10-6-3-1-2-4-7(6)11-8;/h1-4H,5,9H2;1H |
| Molecular Formula | C8H9ClN2S |
| Molecular Weight | 200.6885 |
| Melting point | 254℃ |
| Boiling point | 282°C at 760 mmHg |
| Flash point | 124.4°C |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
29198-41-2 1,3-benzothiazol-2-ylmethylamine hydrochloride
service@apichina.com