| Product Name | 1,3-Benzothiazol-2-ylboronic acid |
| CAS No. | 499769-96-9 |
| Synonyms | 1,3-Benzothiazol-2-Ylboronic Acid,97% |
| InChI | InChI=1/C7H6BNO2S/c10-8(11)7-9-5-3-1-2-4-6(5)12-7/h1-4,10-11H |
| Molecular Formula | C7H6BNO2S |
| Molecular Weight | 179.004 |
| Density | 1.441g/cm3 |
| Melting point | 163.6℃ |
| Boiling point | 388.033°C at 760 mmHg |
| Flash point | 188.476°C |
| Refractive index | 1.677 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
499769-96-9 1,3-benzothiazol-2-ylboronic acid
service@apichina.com