| Product Name | 1-[3-amino-4-(methylamino)phenyl]-1-ethanone |
| CAS No. | 18076-19-2 |
| Synonyms | 1-[3-amino-4-(methylamino)phenyl]ethanone |
| InChI | InChI=1/C9H12N2O/c1-6(12)7-3-4-9(11-2)8(10)5-7/h3-5,11H,10H2,1-2H3 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.2044 |
| Density | 1.15g/cm3 |
| Melting point | 119℃ |
| Boiling point | 360.8°C at 760 mmHg |
| Flash point | 172°C |
| Refractive index | 1.62 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
18076-19-2 1-[3-amino-4-(methylamino)phenyl]-1-ethanone
service@apichina.com