| Product Name | 1,3,4-Thiadiazole-2-carboxylic acid |
| CAS No. | 499770-97-7 |
| InChI | InChI=1/C3H2N2O2S/c6-3(7)2-5-4-1-8-2/h1H,(H,6,7) |
| Molecular Formula | C3H2N2O2S |
| Molecular Weight | 130.1252 |
| Density | 1.671g/cm3 |
| Melting point | 105.2℃ |
| Boiling point | 331.04°C at 760 mmHg |
| Flash point | 154.008°C |
| Refractive index | 1.631 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
499770-97-7 1,3,4-thiadiazole-2-carboxylic acid
service@apichina.com