| Product Name | 1-(3,4-dimethoxyphenyl)ethan-1-one oxime |
| CAS No. | 88920-78-9 |
| Synonyms | 1-(3,4-dimethoxyphenyl)ethanone oxime |
| InChI | InChI=1/C10H13NO3/c1-7(11-12)8-4-5-9(13-2)10(6-8)14-3/h4-6,12H,1-3H3 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.2151 |
| Density | 1.1g/cm3 |
| Melting point | 147℃ |
| Boiling point | 321.3°C at 760 mmHg |
| Flash point | 148.1°C |
| Refractive index | 1.5 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
88920-78-9 1-(3,4-dimethoxyphenyl)ethan-1-one oxime
service@apichina.com