| Product Name | 1-[3-(2,6-dichlorophenyl)isoxazol-5-yl]ethan-1-one |
| CAS No. | 499771-12-9 |
| Synonyms | 1-[3-(2,6-dichlorophenyl)isoxazol-5-yl]ethanone |
| InChI | InChI=1/C11H7Cl2NO2/c1-6(15)10-5-9(14-16-10)11-7(12)3-2-4-8(11)13/h2-5H,1H3 |
| Molecular Formula | C11H7Cl2NO2 |
| Molecular Weight | 256.0848 |
| Density | 1.375g/cm3 |
| Melting point | 116℃ |
| Boiling point | 389.3°C at 760 mmHg |
| Flash point | 189.2°C |
| Refractive index | 1.569 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
499771-12-9 1-[3-(2,6-dichlorophenyl)isoxazol-5-yl]ethan-1-one
service@apichina.com