| Product Name | 1-(2-Thiazolylazo)-2-naphthol |
| CAS No. | 1147-56-4 |
| Synonyms | TAN; 1-(1,3-thiazol-2-ylhydrazono)naphthalen-2(1H)-one; (1Z)-1-(thiazol-2-ylhydrazono)naphthalen-2-one |
| InChI | InChI=1/C13H9N3OS/c17-11-6-5-9-3-1-2-4-10(9)12(11)15-16-13-14-7-8-18-13/h1-8H,(H,14,16)/b15-12- |
| Molecular Formula | C13H9N3OS |
| Molecular Weight | 255.2951 |
| Density | 1.4g/cm3 |
| Melting point | 138-140℃ |
| Boiling point | 523.251°C at 760 mmHg |
| Flash point | 270.253°C |
| Refractive index | 1.728 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1147-56-4 1-(2-thiazolylazo)-2-naphthol
service@apichina.com