| Product Name | 1-(2-Pyrazinyl)-piperazine |
| CAS No. | 34803-68-4 |
| Synonyms | 1-(2-Pyrazinyl)piperazine; 2-piperazin-1-ylpyrazine; 4-pyrazin-2-ylpiperazin-1-ium |
| InChI | InChI=1/C8H12N4/c1-2-11-8(7-10-1)12-5-3-9-4-6-12/h1-2,7,9H,3-6H2/p+1 |
| Molecular Formula | C8H13N4 |
| Molecular Weight | 165.2151 |
| Boiling point | 324.5°C at 760 mmHg |
| Flash point | 150°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
34803-68-4 1-(2-pyrazinyl)-piperazine
service@apichina.com