| Product Name | 1-(2-Phenylethyl)piperazine |
| CAS No. | 5321-49-3 |
| Synonyms | 1-(Phenethyl)piperazine; 1-phenylethyl piperazine; N-(2-Phenylethyl)piperazine; 1-(2-cyclohexylethyl)piperazinediium |
| InChI | InChI=1/C12H24N2/c1-2-4-12(5-3-1)6-9-14-10-7-13-8-11-14/h12-13H,1-11H2/p+2 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.3471 |
| Boiling point | 277.1°C at 760 mmHg |
| Flash point | 99°C |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
5321-49-3 1-(2-phenylethyl)piperazine
service@apichina.com