| Product Name | 1-(2-nitrophenyl)piperidine |
| CAS No. | 15822-77-2 |
| Synonyms | 1-(2-Nitrophenyl)piperidine; 1-(O-Nitrophenyl)piperidine; Piperidine, 1-(2-nitrophenyl)- |
| InChI | InChI=1/C11H14N2O2/c14-13(15)11-7-3-2-6-10(11)12-8-4-1-5-9-12/h2-3,6-7H,1,4-5,8-9H2 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.2411 |
| Density | 1.188g/cm3 |
| Melting point | 77℃ |
| Boiling point | 337.7°C at 760 mmHg |
| Flash point | 158°C |
| Refractive index | 1.578 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
15822-77-2 1-(2-nitrophenyl)piperidine
service@apichina.com