| Product Name | 1,2-Naphthoquinone |
| CAS No. | 524-42-5 |
| Synonyms | 1,2-Naphthalenedione; 1,2-naphthoquinone (beta); naphthalene-1,2-dione |
| InChI | InChI=1/C10H6O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H |
| Molecular Formula | C10H6O2 |
| Molecular Weight | 158.1534 |
| Density | 1.29g/cm3 |
| Melting point | 136-141℃ |
| Boiling point | 296.1°C at 760 mmHg |
| Flash point | 117.4°C |
| Refractive index | 1.617 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
524-42-5 1,2-naphthoquinone
service@apichina.com