| Product Name | 1-(2-Morpholinoethyl)-piperazin |
| CAS No. | 4892-89-1 |
| Synonyms | 1-(2-Morpholinoethyl)-piperazine; 1-[2-(Morpholin-4-yl)ethyl]piperazine; 4-(2-piperazin-1-ylethyl)morpholine; 1-(2-morpholin-4-ium-4-ylethyl)piperazinediium |
| InChI | InChI=1/C10H21N3O/c1-3-12(4-2-11-1)5-6-13-7-9-14-10-8-13/h11H,1-10H2/p+3 |
| Molecular Formula | C10H24N3O |
| Molecular Weight | 202.3154 |
| Boiling point | 292.4°C at 760 mmHg |
| Flash point | 130.6°C |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
4892-89-1 1-(2-morpholinoethyl)-piperazin
service@apichina.com