| Product Name | 1-(2-hydroxyphenyl)-3-phenyl-2-propenone |
| CAS No. | 1214-47-7 |
| Synonyms | 2-Hydroxychalcone; Benzylidene(2-hydroxyacetophenone); 1-(2-Hydroxyphenyl)-3-phenyl-2-propen-1-one; (2E)-1-(2-hydroxyphenyl)-3-phenylprop-2-en-1-one; 2'-Hydroxychalcone; 2'-HYDROXY BENZALACETOPHENONE; 2-Hydroxybenzalacetophenone |
| InChI | InChI=1/C15H12O2/c16-14-9-5-4-8-13(14)15(17)11-10-12-6-2-1-3-7-12/h1-11,16H/b11-10+ |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.2546 |
| Density | 1.191g/cm3 |
| Melting point | 88-92℃ |
| Boiling point | 396.6°C at 760 mmHg |
| Flash point | 169.4°C |
| Refractive index | 1.653 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1214-47-7 1-(2-hydroxyphenyl)-3-phenyl-2-propenone
service@apichina.com