| Product Name | 1-[2-hydroxy-6-(isopentyloxy)phenyl]ethan-1-one |
| CAS No. | 249278-25-9 |
| Synonyms | 1-[2-hydroxy-6-(3-methylbutoxy)phenyl]ethanone |
| InChI | InChI=1/C13H18O3/c1-9(2)7-8-16-12-6-4-5-11(15)13(12)10(3)14/h4-6,9,15H,7-8H2,1-3H3 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.2802 |
| Density | 1.059g/cm3 |
| Melting point | 25℃ |
| Boiling point | 328°C at 760 mmHg |
| Flash point | 118.2°C |
| Refractive index | 1.515 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
249278-25-9 1-[2-hydroxy-6-(isopentyloxy)phenyl]ethan-1-one
service@apichina.com