| Product Name | 1,2-Epoxy-5,9-cyclododecadiene |
| CAS No. | 943-93-1 |
| InChI | InChI=1/C12H18O/c1-2-4-6-8-10-12-11(13-12)9-7-5-3-1/h3-6,11-12H,1-2,7-10H2/b5-3+,6-4+ |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.2707 |
| Density | 0.941g/cm3 |
| Boiling point | 269.8°C at 760 mmHg |
| Flash point | 113.6°C |
| Refractive index | 1.484 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
943-93-1 1,2-epoxy-5,9-cyclododecadiene
service@apichina.com