| Product Name | 1,2-Epoxy-3-methylbutane |
| CAS No. | 1438-14-8 |
| Synonyms | Isopropyloxirane; 2-(propan-2-yl)oxirane; (2S)-2-(1-methylethyl)oxirane |
| InChI | InChI=1/C5H10O/c1-4(2)5-3-6-5/h4-5H,3H2,1-2H3/t5-/m1/s1 |
| Molecular Formula | C5H10O |
| Molecular Weight | 86.1323 |
| Density | 0.893g/cm3 |
| Boiling point | 75.3°C at 760 mmHg |
| Refractive index | 1.425 |
| Risk Codes | R11:Highly flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S33:Take precautionary measures against static discharges.; S36:Wear suitable protective clothing.; |
1438-14-8 1,2-epoxy-3-methylbutane
service@apichina.com