| Product Name | 1,2-Epoxy-2-methylbutane |
| CAS No. | 30095-63-7 |
| Synonyms | alpha-Methyl-alpha-ethylethylene oxide; 2-Ethyl-2-methyloxirane |
| InChI | InChI=1/C5H10O/c1-3-5(2)4-6-5/h3-4H2,1-2H3 |
| Molecular Formula | C5H10O |
| Molecular Weight | 86.1323 |
| Density | 0.858g/cm3 |
| Boiling point | 75.1°C at 760 mmHg |
| Refractive index | 1.408 |
| Hazard Symbols |  F:Highly flammable;  Xi:Irritant; |
| Risk Codes | R11:Highly flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
30095-63-7 1,2-epoxy-2-methylbutane
service@apichina.com