| Product Name | 1,2-Diphenoxyethane |
| CAS No. | 104-66-5 |
| Synonyms | Ethylene glycol diphenyl ether; 1,1'-[ethane-1,2-diylbis(oxy)]dibenzene; 1,2-Diphenoxy ethane |
| InChI | InChI=1/C14H14O2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.2598 |
| Density | 1.08g/cm3 |
| Melting point | 95-98℃ |
| Boiling point | 341.6°C at 760 mmHg |
| Flash point | 139.4°C |
| Refractive index | 1.556 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
104-66-5 1,2-diphenoxyethane
service@apichina.com
- Next:104-67-6;124-25-4 peach aldehyde
- Previous:104-65-4 cinnamyl formate