| Product Name | 1,2-Dimethylcyclohexane |
| CAS No. | 583-57-3 |
| Synonyms | 1,2-Dimethylcyclohexane (cis+trans); (1R,2R)-1,2-dimethylcyclohexane |
| InChI | InChI=1/C8H16/c1-7-5-3-4-6-8(7)2/h7-8H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.2126 |
| Density | 0.766g/cm3 |
| Boiling point | 125.9°C at 760 mmHg |
| Flash point | 15.6°C |
| Refractive index | 1.42 |
| Hazard Symbols |  F:Highly flammable; |
| Risk Codes | R11:Highly flammable.; R38:Irritating to skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S33:Take precautionary measures against static discharges.; S37:Wear suitable gloves.; S9:Keep container in a well-ventilated place.; |
583-57-3 1,2-dimethylcyclohexane
service@apichina.com