| Product Name | 1,2-Dimethyl-4-fluorobenzene |
| CAS No. | 452-64-2 |
| Synonyms | Fluoroxylene2; Fluorooxylene; 3,4-Dimethylfluorobenzene; 4-(Trifluoromethyl)-o-xylene; 4-fluoro-1,2-dimethylbenzene; 1-fluoro-2,4-dimethylbenzene; 4-Fluoro-o-xylene |
| InChI | InChI=1/C8H9F/c1-6-3-4-8(9)7(2)5-6/h3-5H,1-2H3 |
| Molecular Formula | C8H9F |
| Molecular Weight | 124.1555 |
| Density | 0.984g/cm3 |
| Boiling point | 144.62°C at 760 mmHg |
| Flash point | 30.873°C |
| Refractive index | 1.481 |
| Hazard Symbols | |
| Risk Codes | R10:Flammable.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
452-64-2 1,2-dimethyl-4-fluorobenzene
service@apichina.com