| Product Name | 1,2-Dimethoxy-4-nitrobenzene |
| CAS No. | 709-09-1 |
| Synonyms | 4-Nitroveratrole; 1,2-dimethoxy-4-nitro-benzen; 3,4-Dimethoxynitrobenzene; 4-Nitrcveratrole; 4-NITRO-1,2-DIMETHOXYBENZENE; Benzene, 1,2-dimethoxy-4-nitro-; 3,4-dimethoxy-nitrobenzene |
| InChI | InChI=1/C8H7IO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4H,1H3,(H,10,11) |
| Molecular Formula | C8H7IO2 |
| Molecular Weight | 262.0444 |
| Density | 1.867g/cm3 |
| Melting point | 95-98℃ |
| Boiling point | 355.2°C at 760 mmHg |
| Flash point | 168.6°C |
| Refractive index | 1.645 |
| Hazard Symbols | |
| Risk Codes | 22:; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
709-09-1 1,2-dimethoxy-4-nitrobenzene
service@apichina.com