| Product Name | 1,2-Dimethoxy-4,5-dinitrobenzene |
| CAS No. | 3395-03-7;1210-96-4 |
| Synonyms | 4,5-Dinitrocatechol dimethyl ether; 1,5-dimethoxy-2,4-dinitrobenzene; 1,5-dimethoxy-2,4dinitrobenzene; 1,5-dimethoxy-2,4dinitrobenzene; 1,5-Dimethoxy-2,4-dinitrobenzene |
| InChI | InChI=1/C8H8N2O6/c1-15-7-3-5(9(11)12)6(10(13)14)4-8(7)16-2/h3-4H,1-2H3 |
| Molecular Formula | C8H8N2O6 |
| Molecular Weight | 228.1589 |
| Density | 1.416g/cm3 |
| Boiling point | 410.4°C at 760 mmHg |
| Flash point | 205.7°C |
| Refractive index | 1.567 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R5:Heating may cause an explosion.; |
| Safety | S22:Do not inhale dust.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
3395-03-7;1210-96-4 1,2-dimethoxy-4,5-dinitrobenzene
service@apichina.com